C4H8F3O6PS — CID 19427720
2-(trifluoromethylsulfonyloxy)propan-2-ylphosphonic acid (PubChem CID 19427720) has the molecular formula C4H8F3O6PS and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonyloxy)propan-2-ylphosphonic acid.
| Compound Name | 2-(trifluoromethylsulfonyloxy)propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 19427720 |
| Molecular Formula | C4H8F3O6PS |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2-(trifluoromethylsulfonyloxy)propan-2-ylphosphonic acid |
| SMILES | CC(C)(OS(=O)(=O)C(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C4H8F3O6PS/c1-3(2,14(8,9)10)13-15(11,12)4(5,6)7/h1-2H3,(H2,8,9,10) |
| InChIKey | IBZFPNCNVVKZIZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|