C2H2F6NO7PS2 — CID 175318059
[amino(trifluoromethylsulfonyloxy)phosphoryl] trifluoromethanesulfonate (PubChem CID 175318059) has the molecular formula C2H2F6NO7PS2 and a molecular weight of 361.13 g/mol. Its IUPAC name is [amino(trifluoromethylsulfonyloxy)phosphoryl] trifluoromethanesulfonate.
| Compound Name | [amino(trifluoromethylsulfonyloxy)phosphoryl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175318059 |
| Molecular Formula | C2H2F6NO7PS2 |
| Molecular Weight | 361.13 g/mol |
| Exact Mass | 360.89 |
| IUPAC Name | [amino(trifluoromethylsulfonyloxy)phosphoryl] trifluoromethanesulfonate |
| SMILES | NP(=O)(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2H2F6NO7PS2/c3-1(4,5)18(11,12)15-17(9,10)16-19(13,14)2(6,7)8/h(H2,9,10) |
| InChIKey | BNCXVPVVYAUREI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.13 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|