C2H4F3O7PS — CID 141077875
phosphonooxymethyl trifluoromethanesulfonate (PubChem CID 141077875) has the molecular formula C2H4F3O7PS and a molecular weight of 260.08 g/mol. Its IUPAC name is phosphonooxymethyl trifluoromethanesulfonate.
| Compound Name | phosphonooxymethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141077875 |
| Molecular Formula | C2H4F3O7PS |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | phosphonooxymethyl trifluoromethanesulfonate |
| SMILES | O=P(O)(O)OCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2H4F3O7PS/c3-2(4,5)14(9,10)12-1-11-13(6,7)8/h1H2,(H2,6,7,8) |
| InChIKey | ITRIGEMYHQYUAV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|