C13H25F9O15P2S3 — CID 158528601
diethoxyphosphorylmethanol;diethoxyphosphorylmethyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 158528601) has the molecular formula C13H25F9O15P2S3 and a molecular weight of 750.46 g/mol. Its IUPAC name is diethoxyphosphorylmethanol;diethoxyphosphorylmethyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | diethoxyphosphorylmethanol;diethoxyphosphorylmethyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158528601 |
| Molecular Formula | C13H25F9O15P2S3 |
| Molecular Weight | 750.46 g/mol |
| Exact Mass | 749.97 |
| IUPAC Name | diethoxyphosphorylmethanol;diethoxyphosphorylmethyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCOP(=O)(CO)OCC.CCOP(=O)(COS(=O)(=O)C(F)(F)F)OCC.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H12F3O6PS.C5H13O4P.C2F6O5S2/c1-3-13-16(10,14-4-2)5-15-17(11,12)6(7,8)9;1-3-8-10(7,5-6)9-4-2;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h3-5H2,1-2H3;6H,3-5H2,1-2H3; |
| InChIKey | HNBXKMTYZOLDAH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 212.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|