C12H20F3O10PS — CID 89111589
ethyl (2S)-2-[[(1S)-1-(4-methyl-1,3-dioxetan-2-yl)ethoxy]-(trifluoromethylsulfonyloxymethyl)phosphoryl]oxypropanoate (PubChem CID 89111589) has the molecular formula C12H20F3O10PS and a molecular weight of 444.32 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1S)-1-(4-methyl-1,3-dioxetan-2-yl)ethoxy]-(trifluoromethylsulfonyloxymethyl)phosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[[(1S)-1-(4-methyl-1,3-dioxetan-2-yl)ethoxy]-(trifluoromethylsulfonyloxymethyl)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 89111589 |
| Molecular Formula | C12H20F3O10PS |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | ethyl (2S)-2-[[(1S)-1-(4-methyl-1,3-dioxetan-2-yl)ethoxy]-(trifluoromethylsulfonyloxymethyl)phosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(COS(=O)(=O)C(F)(F)F)O[C@@H](C)C1OC(C)O1 |
| InChI | InChI=1S/C12H20F3O10PS/c1-5-20-10(16)7(2)24-26(17,6-21-27(18,19)12(13,14)15)25-8(3)11-22-9(4)23-11/h7-9,11H,5-6H2,1-4H3/t7-,8-,9?,11?,26?/m0/s1 |
| InChIKey | SLAUUNRHYNPRIT-PRFKAOQQSA-N |
| XLogP | 2.10 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|