C3H2F9O16P3S3 — CID 87250966
[[bis(trifluoromethylsulfonyloxy)phosphoryloxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] trifluoromethanesulfonate (PubChem CID 87250966) has the molecular formula C3H2F9O16P3S3 and a molecular weight of 654.14 g/mol. Its IUPAC name is [[bis(trifluoromethylsulfonyloxy)phosphoryloxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] trifluoromethanesulfonate.
| Compound Name | [[bis(trifluoromethylsulfonyloxy)phosphoryloxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87250966 |
| Molecular Formula | C3H2F9O16P3S3 |
| Molecular Weight | 654.14 g/mol |
| Exact Mass | 653.76 |
| IUPAC Name | [[bis(trifluoromethylsulfonyloxy)phosphoryloxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] trifluoromethanesulfonate |
| SMILES | O=P(O)(OP(=O)(O)OS(=O)(=O)C(F)(F)F)OP(=O)(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H2F9O16P3S3/c4-1(5,6)32(18,19)26-30(15,16)24-29(13,14)25-31(17,27-33(20,21)2(7,8)9)28-34(22,23)3(10,11)12/h(H,13,14)(H,15,16) |
| InChIKey | JJHFHNSMVVWVOM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 240.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|