C8H21NdO10P3 — CID 87733443
ditert-butyl [hydroxy(phosphonooxy)phosphoryl] phosphate;neodymium (PubChem CID 87733443) has the molecular formula C8H21NdO10P3 and a molecular weight of 514.41 g/mol. Its IUPAC name is ditert-butyl [hydroxy(phosphonooxy)phosphoryl] phosphate;neodymium.
| Compound Name | ditert-butyl [hydroxy(phosphonooxy)phosphoryl] phosphate;neodymium |
|---|---|
| PubChem CID | 87733443 |
| Molecular Formula | C8H21NdO10P3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | ditert-butyl [hydroxy(phosphonooxy)phosphoryl] phosphate;neodymium |
| SMILES | CC(C)(C)OP(=O)(OC(C)(C)C)OP(=O)(O)OP(=O)(O)O.[Nd] |
| InChI | InChI=1S/C8H21O10P3.Nd/c1-7(2,3)15-21(14,16-8(4,5)6)18-20(12,13)17-19(9,10)11;/h1-6H3,(H,12,13)(H2,9,10,11); |
| InChIKey | AHIIVKJBRFCBNS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|