C9F19O3S — CID 14687560
CID 14687560 (PubChem CID 14687560) has the molecular formula C9F19O3S and a molecular weight of 549.12 g/mol.
| Compound Name | CID 14687560 |
|---|---|
| PubChem CID | 14687560 |
| Molecular Formula | C9F19O3S |
| Molecular Weight | 549.12 g/mol |
| Exact Mass | 548.93 |
| IUPAC Name | — |
| SMILES | O=S(=O)(F)OC(F)([C](C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F19O3S/c10-2(5(13,14)15,6(16,17)18)1(3(11,7(19,20)21)8(22,23)24)4(12,9(25,26)27)31-32(28,29)30 |
| InChIKey | ASLNMBGTSAHBIN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.12 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |