C4H2F6O4S — CID 158427850
2,3,3,3-tetrafluoro-2-(fluorosulfonylmethoxy)propanoyl fluoride (PubChem CID 158427850) has the molecular formula C4H2F6O4S and a molecular weight of 260.11 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(fluorosulfonylmethoxy)propanoyl fluoride.
| Compound Name | 2,3,3,3-tetrafluoro-2-(fluorosulfonylmethoxy)propanoyl fluoride |
|---|---|
| PubChem CID | 158427850 |
| Molecular Formula | C4H2F6O4S |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(fluorosulfonylmethoxy)propanoyl fluoride |
| SMILES | O=C(F)C(F)(OCS(=O)(=O)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F6O4S/c5-2(11)3(6,4(7,8)9)14-1-15(10,12)13/h1H2 |
| InChIKey | UVXNQHZSSYPJSB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|