C5F10O4S — CID 134926549
2-fluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetyl fluoride (PubChem CID 134926549) has the molecular formula C5F10O4S and a molecular weight of 346.10 g/mol. Its IUPAC name is 2-fluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetyl fluoride.
| Compound Name | 2-fluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetyl fluoride |
|---|---|
| PubChem CID | 134926549 |
| Molecular Formula | C5F10O4S |
| Molecular Weight | 346.10 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 2-fluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetyl fluoride |
| SMILES | O=C(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)F |
| InChI | InChI=1S/C5F10O4S/c6-1(16)2(7,20(15,17)18)19-5(13,14)3(8,9)4(10,11)12 |
| InChIKey | HOHTZAXWIVFTLK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.10 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|