C9F18O5S — CID 134925931
1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 134925931) has the molecular formula C9F18O5S and a molecular weight of 562.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 134925931 |
| Molecular Formula | C9F18O5S |
| Molecular Weight | 562.12 g/mol |
| Exact Mass | 561.92 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | O=C(OC(F)(F)C(F)(F)C(F)(F)F)C(OC(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)F)S(=O)(=O)F |
| InChI | InChI=1S/C9F18O5S/c10-3(11,6(17,18)19)8(23,24)31-1(28)2(5(14,15)16,33(27,29)30)32-9(25,26)4(12,13)7(20,21)22 |
| InChIKey | JWMGXXHCPXAMBV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.12 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|