C7F14O4S — CID 134925930
1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(trifluoromethyl)propanoate (PubChem CID 134925930) has the molecular formula C7F14O4S and a molecular weight of 446.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(trifluoromethyl)propanoate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 134925930 |
| Molecular Formula | C7F14O4S |
| Molecular Weight | 446.11 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl 3,3,3-trifluoro-2-fluorosulfonyl-2-(trifluoromethyl)propanoate |
| SMILES | O=C(OC(F)(F)C(F)(F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)F |
| InChI | InChI=1S/C7F14O4S/c8-3(9,6(16,17)18)7(19,20)25-1(22)2(4(10,11)12,5(13,14)15)26(21,23)24 |
| InChIKey | DSRRPGQAEOPXAX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|