C8F15O3- — CID 154502767
[1,1,2,2,4,4,5,5,5-nonafluoro-3,3-bis(trifluoromethyl)pentyl] carbonate (PubChem CID 154502767) has the molecular formula C8F15O3- and a molecular weight of 429.06 g/mol. Its IUPAC name is [1,1,2,2,4,4,5,5,5-nonafluoro-3,3-bis(trifluoromethyl)pentyl] carbonate.
| Compound Name | [1,1,2,2,4,4,5,5,5-nonafluoro-3,3-bis(trifluoromethyl)pentyl] carbonate |
|---|---|
| PubChem CID | 154502767 |
| Molecular Formula | C8F15O3- |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | [1,1,2,2,4,4,5,5,5-nonafluoro-3,3-bis(trifluoromethyl)pentyl] carbonate |
| SMILES | O=C([O-])OC(F)(F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O3/c9-3(10,7(19,20)21)2(5(13,14)15,6(16,17)18)4(11,12)8(22,23)26-1(24)25/h(H,24,25)/p-1 |
| InChIKey | RNPYDJBWNIQXCB-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|