C2F5NO4S — CID 13024147
1,1,2,2-tetrafluoro-1-fluorosulfonyloxy-2-nitrosoethane (PubChem CID 13024147) has the molecular formula C2F5NO4S and a molecular weight of 229.08 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-fluorosulfonyloxy-2-nitrosoethane.
| Compound Name | 1,1,2,2-tetrafluoro-1-fluorosulfonyloxy-2-nitrosoethane |
|---|---|
| PubChem CID | 13024147 |
| Molecular Formula | C2F5NO4S |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-fluorosulfonyloxy-2-nitrosoethane |
| SMILES | O=NC(F)(F)C(F)(F)OS(=O)(=O)F |
| InChI | InChI=1S/C2F5NO4S/c3-1(4,8-9)2(5,6)12-13(7,10)11 |
| InChIKey | GXMSRFUBWICMJX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|