C3BF9O — CID 158763701
difluoro(1,1,2,2,3,3,3-heptafluoropropoxy)borane (PubChem CID 158763701) has the molecular formula C3BF9O and a molecular weight of 233.83 g/mol. Its IUPAC name is difluoro(1,1,2,2,3,3,3-heptafluoropropoxy)borane.
| Compound Name | difluoro(1,1,2,2,3,3,3-heptafluoropropoxy)borane |
|---|---|
| PubChem CID | 158763701 |
| Molecular Formula | C3BF9O |
| Molecular Weight | 233.83 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | difluoro(1,1,2,2,3,3,3-heptafluoropropoxy)borane |
| SMILES | FB(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3BF9O/c5-1(6,2(7,8)9)3(10,11)14-4(12)13 |
| InChIKey | IOZLWRRGKSDZPV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|