3,4,4-trifluorobut-3-ene-1-sulfonic acid

C4H5F3O3S — CID 87155665

IUPAC3,4,4-trifluorobut-3-ene-1-sulfonic acid
SMILESO=S(=O)(O)CCC(F)=C(F)F
InChIInChI=1S/C4H5F3O3S/c5-3(4(6)7)1-2-11(8,9)10/h1-2H2,(H,8,9,10)
InChIKeyWRKCMLHZMLZNIL-UHFFFAOYSA-N
MW190.14 g/mol
LogP1.34
Rot. Bonds3

About 3,4,4-trifluorobut-3-ene-1-sulfonic acid

3,4,4-trifluorobut-3-ene-1-sulfonic acid (PubChem CID 87155665) has the molecular formula C4H5F3O3S and a molecular weight of 190.14 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-ene-1-sulfonic acid.

Molecular Properties

Compound Name3,4,4-trifluorobut-3-ene-1-sulfonic acid
PubChem CID87155665
Molecular FormulaC4H5F3O3S
Molecular Weight190.14 g/mol
Exact Mass189.99
IUPAC Name3,4,4-trifluorobut-3-ene-1-sulfonic acid
SMILESO=S(=O)(O)CCC(F)=C(F)F
InChIInChI=1S/C4H5F3O3S/c5-3(4(6)7)1-2-11(8,9)10/h1-2H2,(H,8,9,10)
InChIKeyWRKCMLHZMLZNIL-UHFFFAOYSA-N
XLogP1.34
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.14
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3,4,4-trifluorobut-3-ene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,4-trifluorobut-3-ene-1-sulfonic acid?
The IUPAC name of 3,4,4-trifluorobut-3-ene-1-sulfonic acid (CID 87155665) is 3,4,4-trifluorobut-3-ene-1-sulfonic acid.
What is the SMILES notation for 3,4,4-trifluorobut-3-ene-1-sulfonic acid?
The canonical SMILES for 3,4,4-trifluorobut-3-ene-1-sulfonic acid is O=S(=O)(O)CCC(F)=C(F)F.
What is the InChIKey of 3,4,4-trifluorobut-3-ene-1-sulfonic acid?
The InChIKey is WRKCMLHZMLZNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O3S/c5-3(4(6)7)1-2-11(8,9)10/h1-2H2,(H,8,9,10).
What are the key properties of 3,4,4-trifluorobut-3-ene-1-sulfonic acid?
3,4,4-trifluorobut-3-ene-1-sulfonic acid has a molecular weight of 190.14 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4-trifluorobut-3-ene-1-sulfonic acid is sourced from PubChem (CID 87155665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).