C7H12F3NO2S — CID 58684554
3-(3,4,4-trifluorobut-3-enylsulfonyl)propan-1-amine (PubChem CID 58684554) has the molecular formula C7H12F3NO2S and a molecular weight of 231.24 g/mol. Its IUPAC name is 3-(3,4,4-trifluorobut-3-enylsulfonyl)propan-1-amine.
| Compound Name | 3-(3,4,4-trifluorobut-3-enylsulfonyl)propan-1-amine |
|---|---|
| PubChem CID | 58684554 |
| Molecular Formula | C7H12F3NO2S |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-(3,4,4-trifluorobut-3-enylsulfonyl)propan-1-amine |
| SMILES | NCCCS(=O)(=O)CCC(F)=C(F)F |
| InChI | InChI=1S/C7H12F3NO2S/c8-6(7(9)10)2-5-14(12,13)4-1-3-11/h1-5,11H2 |
| InChIKey | RDYYZWDCKCLUSF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |