About sodium;carbanide;2-hydroxyethanesulfonic acid
sodium;carbanide;2-hydroxyethanesulfonic acid (PubChem CID 134208843) has the molecular formula C3H9NaO4S
and a molecular weight of 164.16 g/mol. Its IUPAC name is sodium;carbanide;2-hydroxyethanesulfonic acid.
Molecular Properties
| Compound Name | sodium;carbanide;2-hydroxyethanesulfonic acid |
| PubChem CID | 134208843 |
| Molecular Formula | C3H9NaO4S |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | sodium;carbanide;2-hydroxyethanesulfonic acid |
| SMILES | O=S(=O)(O)CCO.[CH3-].[Na+] |
| InChI | InChI=1S/C2H6O4S.CH3.Na/c3-1-2-7(4,5)6;;/h3H,1-2H2,(H,4,5,6);1H3;/q;-1;+1 |
| InChIKey | MMTAGXCQROPLLI-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbanide;2-hydroxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbanide;2-hydroxyethanesulfonic acid?
The IUPAC name of sodium;carbanide;2-hydroxyethanesulfonic acid (CID 134208843) is sodium;carbanide;2-hydroxyethanesulfonic acid.
What is the SMILES notation for sodium;carbanide;2-hydroxyethanesulfonic acid?
The canonical SMILES for sodium;carbanide;2-hydroxyethanesulfonic acid is O=S(=O)(O)CCO.[CH3-].[Na+].
What is the InChIKey of sodium;carbanide;2-hydroxyethanesulfonic acid?
The InChIKey is MMTAGXCQROPLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O4S.CH3.Na/c3-1-2-7(4,5)6;;/h3H,1-2H2,(H,4,5,6);1H3;/q;-1;+1.
What are the key properties of sodium;carbanide;2-hydroxyethanesulfonic acid?
sodium;carbanide;2-hydroxyethanesulfonic acid has a molecular weight of 164.16 g/mol, XLogP of -3.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbanide;2-hydroxyethanesulfonic acid is sourced from PubChem (CID 134208843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).