About sodium;2-hydroxyethanesulfonic acid;methanamine
sodium;2-hydroxyethanesulfonic acid;methanamine (PubChem CID 175372876) has the molecular formula C3H10NNaO4S
and a molecular weight of 179.17 g/mol. Its IUPAC name is sodium;2-hydroxyethanesulfonic acid;methanamine.
Molecular Properties
| Compound Name | sodium;2-hydroxyethanesulfonic acid;methanamine |
| PubChem CID | 175372876 |
| Molecular Formula | C3H10NNaO4S |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | sodium;2-hydroxyethanesulfonic acid;methanamine |
| SMILES | O=S(=O)(O)CCO.[CH2-]N.[Na+] |
| InChI | InChI=1S/C2H6O4S.CH4N.Na/c3-1-2-7(4,5)6;1-2;/h3H,1-2H2,(H,4,5,6);1-2H2;/q;-1;+1 |
| InChIKey | UYCXADUVLOOSFG-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-hydroxyethanesulfonic acid;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxyethanesulfonic acid;methanamine?
The IUPAC name of sodium;2-hydroxyethanesulfonic acid;methanamine (CID 175372876) is sodium;2-hydroxyethanesulfonic acid;methanamine.
What is the SMILES notation for sodium;2-hydroxyethanesulfonic acid;methanamine?
The canonical SMILES for sodium;2-hydroxyethanesulfonic acid;methanamine is O=S(=O)(O)CCO.[CH2-]N.[Na+].
What is the InChIKey of sodium;2-hydroxyethanesulfonic acid;methanamine?
The InChIKey is UYCXADUVLOOSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O4S.CH4N.Na/c3-1-2-7(4,5)6;1-2;/h3H,1-2H2,(H,4,5,6);1-2H2;/q;-1;+1.
What are the key properties of sodium;2-hydroxyethanesulfonic acid;methanamine?
sodium;2-hydroxyethanesulfonic acid;methanamine has a molecular weight of 179.17 g/mol, XLogP of -4.39, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxyethanesulfonic acid;methanamine is sourced from PubChem (CID 175372876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).