C8H17NO8S — CID 89422112
3-(2-carboxyethylamino)propanoic acid;2-hydroxyethanesulfonic acid (PubChem CID 89422112) has the molecular formula C8H17NO8S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(2-carboxyethylamino)propanoic acid;2-hydroxyethanesulfonic acid.
| Compound Name | 3-(2-carboxyethylamino)propanoic acid;2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 89422112 |
| Molecular Formula | C8H17NO8S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-(2-carboxyethylamino)propanoic acid;2-hydroxyethanesulfonic acid |
| SMILES | O=C(O)CCNCCC(=O)O.O=S(=O)(O)CCO |
| InChI | InChI=1S/C6H11NO4.C2H6O4S/c8-5(9)1-3-7-4-2-6(10)11;3-1-2-7(4,5)6/h7H,1-4H2,(H,8,9)(H,10,11);3H,1-2H2,(H,4,5,6) |
| InChIKey | RTRTVQIVWNSDSN-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|