C14H24O4S2 — CID 13396195
2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethyl-1,1-dioxothietan-3-ylidene)thietane 1,1-dioxide (PubChem CID 13396195) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethyl-1,1-dioxothietan-3-ylidene)thietane 1,1-dioxide.
| Compound Name | 2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethyl-1,1-dioxothietan-3-ylidene)thietane 1,1-dioxide |
|---|---|
| PubChem CID | 13396195 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethyl-1,1-dioxothietan-3-ylidene)thietane 1,1-dioxide |
| SMILES | CC1(C)C(=C2C(C)(C)S(=O)(=O)C2(C)C)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C14H24O4S2/c1-11(2)9(12(3,4)19(11,15)16)10-13(5,6)20(17,18)14(10,7)8/h1-8H3 |
| InChIKey | KHYVJQKQKOQDPB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|