C10H10F6O2 — CID 154416702
1,4,4,5,5,6-hexafluoro-6-propan-2-ylcyclohex-2-ene-1-carboxylic acid (PubChem CID 154416702) has the molecular formula C10H10F6O2 and a molecular weight of 276.18 g/mol. Its IUPAC name is 1,4,4,5,5,6-hexafluoro-6-propan-2-ylcyclohex-2-ene-1-carboxylic acid.
| Compound Name | 1,4,4,5,5,6-hexafluoro-6-propan-2-ylcyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 154416702 |
| Molecular Formula | C10H10F6O2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1,4,4,5,5,6-hexafluoro-6-propan-2-ylcyclohex-2-ene-1-carboxylic acid |
| SMILES | CC(C)C1(F)C(F)(C(=O)O)C=CC(F)(F)C1(F)F |
| InChI | InChI=1S/C10H10F6O2/c1-5(2)9(14)7(11,6(17)18)3-4-8(12,13)10(9,15)16/h3-5H,1-2H3,(H,17,18) |
| InChIKey | XSTUWRBOVYEFJG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|