C5Cl5F5O — CID 59509990
1,1-dichloro-2,2,3-trifluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)cyclopropane (PubChem CID 59509990) has the molecular formula C5Cl5F5O and a molecular weight of 348.31 g/mol. Its IUPAC name is 1,1-dichloro-2,2,3-trifluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)cyclopropane.
| Compound Name | 1,1-dichloro-2,2,3-trifluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)cyclopropane |
|---|---|
| PubChem CID | 59509990 |
| Molecular Formula | C5Cl5F5O |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 345.83 |
| IUPAC Name | 1,1-dichloro-2,2,3-trifluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)cyclopropane |
| SMILES | FC(Cl)(Cl)C(F)(Cl)OC1(F)C(F)(F)C1(Cl)Cl |
| InChI | InChI=1S/C5Cl5F5O/c6-1(7)2(11,12)3(1,13)16-5(10,15)4(8,9)14 |
| InChIKey | YDZFNUIHCGXIAG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|