C14H18F10O2 — CID 21325420
1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-bis[(2-methylpropan-2-yl)oxy]cyclohexane (PubChem CID 21325420) has the molecular formula C14H18F10O2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-bis[(2-methylpropan-2-yl)oxy]cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-bis[(2-methylpropan-2-yl)oxy]cyclohexane |
|---|---|
| PubChem CID | 21325420 |
| Molecular Formula | C14H18F10O2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-bis[(2-methylpropan-2-yl)oxy]cyclohexane |
| SMILES | CC(C)(C)OC1(OC(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H18F10O2/c1-7(2,3)25-14(26-8(4,5)6)12(21,22)10(17,18)9(15,16)11(19,20)13(14,23)24/h1-6H3 |
| InChIKey | VFCIDKDVODOGKE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|