C9H9F9 — CID 175402801
1-tert-butyl-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane (PubChem CID 175402801) has the molecular formula C9H9F9 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1-tert-butyl-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane.
| Compound Name | 1-tert-butyl-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane |
|---|---|
| PubChem CID | 175402801 |
| Molecular Formula | C9H9F9 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-tert-butyl-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane |
| SMILES | CC(C)(C)C1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F9/c1-4(2,3)5(10)6(11,12)8(15,16)9(17,18)7(5,13)14/h1-3H3 |
| InChIKey | XHTMNLKDOUZIIV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|