C13H18F8O2 — CID 162482348
1-tert-butyl-2-(1,1-difluoroethyl)-1,2,3,3,5,5-hexafluoro-4,4-dimethoxycyclopentane (PubChem CID 162482348) has the molecular formula C13H18F8O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-tert-butyl-2-(1,1-difluoroethyl)-1,2,3,3,5,5-hexafluoro-4,4-dimethoxycyclopentane.
| Compound Name | 1-tert-butyl-2-(1,1-difluoroethyl)-1,2,3,3,5,5-hexafluoro-4,4-dimethoxycyclopentane |
|---|---|
| PubChem CID | 162482348 |
| Molecular Formula | C13H18F8O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-tert-butyl-2-(1,1-difluoroethyl)-1,2,3,3,5,5-hexafluoro-4,4-dimethoxycyclopentane |
| SMILES | COC1(OC)C(F)(F)C(F)(C(C)(C)C)C(F)(C(C)(F)F)C1(F)F |
| InChI | InChI=1S/C13H18F8O2/c1-7(2,3)9(16)10(17,8(4,14)15)12(20,21)13(22-5,23-6)11(9,18)19/h1-6H3 |
| InChIKey | HVBMUJZRJNUQHL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|