C9H17ClO5 — CID 12600057
2-chloro-3,3,4,4-tetramethoxy-2-methylcyclobutan-1-ol (PubChem CID 12600057) has the molecular formula C9H17ClO5 and a molecular weight of 240.68 g/mol. Its IUPAC name is 2-chloro-3,3,4,4-tetramethoxy-2-methylcyclobutan-1-ol.
| Compound Name | 2-chloro-3,3,4,4-tetramethoxy-2-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 12600057 |
| Molecular Formula | C9H17ClO5 |
| Molecular Weight | 240.68 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-chloro-3,3,4,4-tetramethoxy-2-methylcyclobutan-1-ol |
| SMILES | COC1(OC)C(O)C(C)(Cl)C1(OC)OC |
| InChI | InChI=1S/C9H17ClO5/c1-7(10)6(11)8(12-2,13-3)9(7,14-4)15-5/h6,11H,1-5H3 |
| InChIKey | LRFOKKVOUQHCLO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.68 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|