C17H22Cl4O4 — CID 10928177
(1R,2R,5S,6R,7S,8S)-1,8,9,10-tetrachloro-6-hydroxy-11,11-dimethoxy-2-methyl-5-propan-2-yltricyclo[6.2.1.02,7]undec-9-en-3-one (PubChem CID 10928177) has the molecular formula C17H22Cl4O4 and a molecular weight of 432.17 g/mol. Its IUPAC name is (1R,2R,5S,6R,7S,8S)-1,8,9,10-tetrachloro-6-hydroxy-11,11-dimethoxy-2-methyl-5-propan-2-yltricyclo[6.2.1.02,7]undec-9-en-3-one.
| Compound Name | (1R,2R,5S,6R,7S,8S)-1,8,9,10-tetrachloro-6-hydroxy-11,11-dimethoxy-2-methyl-5-propan-2-yltricyclo[6.2.1.02,7]undec-9-en-3-one |
|---|---|
| PubChem CID | 10928177 |
| Molecular Formula | C17H22Cl4O4 |
| Molecular Weight | 432.17 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | (1R,2R,5S,6R,7S,8S)-1,8,9,10-tetrachloro-6-hydroxy-11,11-dimethoxy-2-methyl-5-propan-2-yltricyclo[6.2.1.02,7]undec-9-en-3-one |
| SMILES | COC1(OC)[C@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@@]1(C)C(=O)C[C@@H](C(C)C)[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C17H22Cl4O4/c1-7(2)8-6-9(22)14(3)11(10(8)23)15(20)12(18)13(19)16(14,21)17(15,24-4)25-5/h7-8,10-11,23H,6H2,1-5H3/t8-,10+,11+,14-,15+,16+/m0/s1 |
| InChIKey | WPUPQVPWRQHITQ-SRJKTDRMSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|