C11H14Cl4O3 — CID 22095251
[(1R,4R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanol (PubChem CID 22095251) has the molecular formula C11H14Cl4O3 and a molecular weight of 336.04 g/mol. Its IUPAC name is [(1R,4R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanol.
| Compound Name | [(1R,4R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanol |
|---|---|
| PubChem CID | 22095251 |
| Molecular Formula | C11H14Cl4O3 |
| Molecular Weight | 336.04 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | [(1R,4R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C(CO)C2C |
| InChI | InChI=1S/C11H14Cl4O3/c1-5-6(4-16)10(15)8(13)7(12)9(5,14)11(10,17-2)18-3/h5-6,16H,4H2,1-3H3/t5?,6?,9-,10-/m0/s1 |
| InChIKey | FUTGMLKIRMZKMH-IKCWNFIPSA-N |
| XLogP | 2.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.04 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|