C18H16Cl4O2 — CID 98555477
(1S,2R,3S,6R,7S,8S)-3,4,5,6-tetrachloro-16,16-dimethoxypentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene (PubChem CID 98555477) has the molecular formula C18H16Cl4O2 and a molecular weight of 406.14 g/mol. Its IUPAC name is (1S,2R,3S,6R,7S,8S)-3,4,5,6-tetrachloro-16,16-dimethoxypentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene.
| Compound Name | (1S,2R,3S,6R,7S,8S)-3,4,5,6-tetrachloro-16,16-dimethoxypentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
|---|---|
| PubChem CID | 98555477 |
| Molecular Formula | C18H16Cl4O2 |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | (1S,2R,3S,6R,7S,8S)-3,4,5,6-tetrachloro-16,16-dimethoxypentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@H]1[C@@H]2[C@@H]2C[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C18H16Cl4O2/c1-23-18(24-2)16(21)12-10-7-11(9-6-4-3-5-8(9)10)13(12)17(18,22)15(20)14(16)19/h3-6,10-13H,7H2,1-2H3/t10-,11-,12-,13+,16-,17+/m1/s1 |
| InChIKey | WKKQGHSXCFJKSR-POKDXMDSSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|