C20H8Cl12 — CID 13032855
(1S,2S,3S,4S,7R,8S,15S,16R)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene (PubChem CID 13032855) has the molecular formula C20H8Cl12 and a molecular weight of 673.72 g/mol. Its IUPAC name is (1S,2S,3S,4S,7R,8S,15S,16R)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene.
| Compound Name | (1S,2S,3S,4S,7R,8S,15S,16R)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
|---|---|
| PubChem CID | 13032855 |
| Molecular Formula | C20H8Cl12 |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 667.69 |
| IUPAC Name | (1S,2S,3S,4S,7R,8S,15S,16R)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)[C@@H]3c4ccccc4[C@@H]4[C@H]([C@@H]3[C@@]1(Cl)C2(Cl)Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@@]4(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C20H8Cl12/c21-11-13(23)17(27)9-7(15(11,25)19(17,29)30)5-3-1-2-4-6(5)8-10(9)18(28)14(24)12(22)16(8,26)20(18,31)32/h1-4,7-10H/t7-,8-,9-,10-,15-,16-,17+,18+/m1/s1 |
| InChIKey | ULBZLTIPWBXWCY-NUCQHSGMSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|