C20H6Cl12INO2 — CID 99656397
(1S,2R,3R,4S,7S,8R,15S,16S)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachloro-11-iodo-12-nitrohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene (PubChem CID 99656397) has the molecular formula C20H6Cl12INO2 and a molecular weight of 844.61 g/mol. Its IUPAC name is (1S,2R,3R,4S,7S,8R,15S,16S)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachloro-11-iodo-12-nitrohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene.
| Compound Name | (1S,2R,3R,4S,7S,8R,15S,16S)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachloro-11-iodo-12-nitrohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
|---|---|
| PubChem CID | 99656397 |
| Molecular Formula | C20H6Cl12INO2 |
| Molecular Weight | 844.61 g/mol |
| Exact Mass | 838.57 |
| IUPAC Name | (1S,2R,3R,4S,7S,8R,15S,16S)-1,4,5,6,7,16,17,18,19,19,20,20-dodecachloro-11-iodo-12-nitrohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
| SMILES | O=[N+]([O-])c1cc2c(cc1I)[C@H]1[C@@H]([C@@H]3[C@@H]2[C@]2(Cl)C(Cl)=C(Cl)[C@]3(Cl)C2(Cl)Cl)[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C20H6Cl12INO2/c21-11-13(23)17(27)9-7(15(11,25)19(17,29)30)3-1-5(33)6(34(35)36)2-4(3)8-10(9)18(28)14(24)12(22)16(8,26)20(18,31)32/h1-2,7-10H/t7-,8+,9-,10-,15-,16-,17-,18-/m0/s1 |
| InChIKey | LWWGOSNUXCTQNH-YCYQBQBNSA-N |
| XLogP | 10.30 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.61 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|