C19H18Cl4O2 — CID 98163475
(1S,2S,3R,6S,7S,8S)-3,4,5,6-tetrachloro-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene (PubChem CID 98163475) has the molecular formula C19H18Cl4O2 and a molecular weight of 420.16 g/mol. Its IUPAC name is (1S,2S,3R,6S,7S,8S)-3,4,5,6-tetrachloro-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene.
| Compound Name | (1S,2S,3R,6S,7S,8S)-3,4,5,6-tetrachloro-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene |
|---|---|
| PubChem CID | 98163475 |
| Molecular Formula | C19H18Cl4O2 |
| Molecular Weight | 420.16 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (1S,2S,3R,6S,7S,8S)-3,4,5,6-tetrachloro-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@@H]1[C@@H]2[C@@H]2CC[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C19H18Cl4O2/c1-24-19(25-2)17(22)13-11-7-8-12(10-6-4-3-5-9(10)11)14(13)18(19,23)16(21)15(17)20/h3-6,11-14H,7-8H2,1-2H3/t11-,12-,13+,14+,17-,18+/m1/s1 |
| InChIKey | DALTUKWWYJSZDX-JUFXHULESA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.16 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|