C19H22O2 — CID 124922524
(1R,2S,3S,6S,7S,8R)-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene (PubChem CID 124922524) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2S,3S,6S,7S,8R)-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene.
| Compound Name | (1R,2S,3S,6S,7S,8R)-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene |
|---|---|
| PubChem CID | 124922524 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1R,2S,3S,6S,7S,8R)-17,17-dimethoxypentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene |
| SMILES | COC1(OC)[C@H]2C=C[C@H]1[C@H]1[C@H]2[C@H]2CC[C@H]1c1ccccc12 |
| InChI | InChI=1S/C19H22O2/c1-20-19(21-2)15-9-10-16(19)18-14-8-7-13(17(15)18)11-5-3-4-6-12(11)14/h3-6,9-10,13-18H,7-8H2,1-2H3/t13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | TXQRANBDSQOWKX-QQCJEOGWSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|