C21H29NO2 — CID 71272675
(8S,9S,13S,14S)-7-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carboxamide (PubChem CID 71272675) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (8S,9S,13S,14S)-7-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carboxamide.
| Compound Name | (8S,9S,13S,14S)-7-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carboxamide |
|---|---|
| PubChem CID | 71272675 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (8S,9S,13S,14S)-7-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carboxamide |
| SMILES | CNC(=O)C1c2ccccc2[C@H]2CC[C@]3(C)CCC[C@H]3[C@@H]2C1OC |
| InChI | InChI=1S/C21H29NO2/c1-21-11-6-9-16(21)17-15(10-12-21)13-7-4-5-8-14(13)18(19(17)24-3)20(23)22-2/h4-5,7-8,15-19H,6,9-12H2,1-3H3,(H,22,23)/t15-,16+,17-,18?,19?,21+/m1/s1 |
| InChIKey | VQOQIYGRFUGTLW-QLGPBJSTSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |