C26H36O3 — CID 99572082
[(3R,5R,7S,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 99572082) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is [(3R,5R,7S,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(3R,5R,7S,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 99572082 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [(3R,5R,7S,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1[C@@H](OC(=O)c3ccccc3)C[C@H]3C[C@H](O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C26H36O3/c1-25-12-6-9-20(25)23-21(11-13-25)26(2)14-10-19(27)15-18(26)16-22(23)29-24(28)17-7-4-3-5-8-17/h3-5,7-8,18-23,27H,6,9-16H2,1-2H3/t18-,19-,20+,21+,22+,23+,25+,26+/m1/s1 |
| InChIKey | XUOUHDBVBHWSFC-DHCXFDNTSA-N |
| XLogP | 5.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |