C20H30O3 — CID 69492537
(7S,8S,9S,10R,13S,14S)-7-methoxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 69492537) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (7S,8S,9S,10R,13S,14S)-7-methoxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (7S,8S,9S,10R,13S,14S)-7-methoxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 69492537 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (7S,8S,9S,10R,13S,14S)-7-methoxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CO[C@H]1CC2C=C(O)C(O)=C[C@]2(C)[C@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H30O3/c1-19-7-4-5-13(19)18-14(6-8-19)20(2)11-16(22)15(21)9-12(20)10-17(18)23-3/h9,11-14,17-18,21-22H,4-8,10H2,1-3H3/t12?,13-,14-,17-,18-,19-,20-/m0/s1 |
| InChIKey | PBSGPKWZIMYKLA-MTBSZBKMSA-N |
| XLogP | 4.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |