C19H30O3 — CID 90949585
(8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1,7-triol (PubChem CID 90949585) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1,7-triol.
| Compound Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1,7-triol |
|---|---|
| PubChem CID | 90949585 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1,7-triol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C(O)C=C3CCCC(O)(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O3/c1-17-8-4-6-13(17)16-14(7-10-17)18(2)12(11-15(16)20)5-3-9-19(18,21)22/h11,13-16,20-22H,3-10H2,1-2H3/t13-,14-,15?,16-,17-,18-/m0/s1 |
| InChIKey | RYBHKJNMORWLNS-WAIDEDKFSA-N |
| XLogP | 2.99 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|