C25H36O6 — CID 67668397
[(7R,8S,9S,10S,13S,14S)-1,1-diacetyloxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 67668397) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(7R,8S,9S,10S,13S,14S)-1,1-diacetyloxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(7R,8S,9S,10S,13S,14S)-1,1-diacetyloxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 67668397 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(7R,8S,9S,10S,13S,14S)-1,1-diacetyloxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2CC=CC(OC(C)=O)(OC(C)=O)[C@]2(C)[C@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H36O6/c1-15(26)29-21-14-18-8-6-12-25(30-16(2)27,31-17(3)28)24(18,5)20-10-13-23(4)11-7-9-19(23)22(20)21/h6,12,18-22H,7-11,13-14H2,1-5H3/t18?,19-,20-,21+,22-,23-,24-/m0/s1 |
| InChIKey | NECKEAXQYSTNIX-XEUSUFCJSA-N |
| XLogP | 4.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|