C19H17Cl4NO4 — CID 98467723
(1R,2R,6R,7R)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-(2-phenylethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98467723) has the molecular formula C19H17Cl4NO4 and a molecular weight of 465.16 g/mol. Its IUPAC name is (1R,2R,6R,7R)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-(2-phenylethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-(2-phenylethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98467723 |
| Molecular Formula | C19H17Cl4NO4 |
| Molecular Weight | 465.16 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | (1R,2R,6R,7R)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-(2-phenylethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@H]1C(=O)N(CCc3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H17Cl4NO4/c1-27-19(28-2)17(22)11-12(18(19,23)14(21)13(17)20)16(26)24(15(11)25)9-8-10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12-,17+,18+/m1/s1 |
| InChIKey | ZZGFPBLZZWMEIN-VVDPLQPHSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|