C17H20N2O4 — CID 91916002
(3aS,6aR)-2-(2-methoxyacetyl)-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91916002) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (3aS,6aR)-2-(2-methoxyacetyl)-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-2-(2-methoxyacetyl)-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91916002 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3aS,6aR)-2-(2-methoxyacetyl)-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | COCC(=O)N1C[C@@H]2C(=O)N(CCc3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H20N2O4/c1-23-11-15(20)18-9-13-14(10-18)17(22)19(16(13)21)8-7-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3/t13-,14+ |
| InChIKey | WRTQVMRCZUGPSW-OKILXGFUSA-N |
| XLogP | 0.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|