C20H25ClN2O2 — CID 120746836
1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-(2-phenylethoxy)ethanone;hydrochloride (PubChem CID 120746836) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-(2-phenylethoxy)ethanone;hydrochloride.
| Compound Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-(2-phenylethoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120746836 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-(2-phenylethoxy)ethanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(C(=O)COCCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2.ClH/c21-19-14-22(13-18(19)17-9-5-2-6-10-17)20(23)15-24-12-11-16-7-3-1-4-8-16;/h1-10,18-19H,11-15,21H2;1H/t18-,19+;/m0./s1 |
| InChIKey | ABWTXLVGJCFRSM-GRTNUQQKSA-N |
| XLogP | 2.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|