C16H25ClN2O2 — CID 120742989
1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-propoxyethanone;hydrochloride (PubChem CID 120742989) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-propoxyethanone;hydrochloride.
| Compound Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-propoxyethanone;hydrochloride |
|---|---|
| PubChem CID | 120742989 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-propoxyethanone;hydrochloride |
| SMILES | CCCOCC(=O)N1C[C@@H](CN)[C@H](c2ccccc2)C1.Cl |
| InChI | InChI=1S/C16H24N2O2.ClH/c1-2-8-20-12-16(19)18-10-14(9-17)15(11-18)13-6-4-3-5-7-13;/h3-7,14-15H,2,8-12,17H2,1H3;1H/t14-,15+;/m1./s1 |
| InChIKey | CSJGOUHFFRLQMY-LIOBNPLQSA-N |
| XLogP | 2.04 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|