C22H29ClN2O2 — CID 120748525
1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-(2-phenylethoxy)butan-1-one;hydrochloride (PubChem CID 120748525) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-(2-phenylethoxy)butan-1-one;hydrochloride.
| Compound Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-(2-phenylethoxy)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120748525 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-(2-phenylethoxy)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(C(=O)CCCOCCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H28N2O2.ClH/c23-21-17-24(16-20(21)19-10-5-2-6-11-19)22(25)12-7-14-26-15-13-18-8-3-1-4-9-18;/h1-6,8-11,20-21H,7,12-17,23H2;1H/t20-,21+;/m0./s1 |
| InChIKey | BNQPWCKJXDUILN-JUDYQFGCSA-N |
| XLogP | 3.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|