C24H32N2O3 — CID 120742966
1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-[4-(2-methoxyethyl)phenoxy]butan-1-one (PubChem CID 120742966) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-[4-(2-methoxyethyl)phenoxy]butan-1-one.
| Compound Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-[4-(2-methoxyethyl)phenoxy]butan-1-one |
|---|---|
| PubChem CID | 120742966 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-[4-(2-methoxyethyl)phenoxy]butan-1-one |
| SMILES | COCCc1ccc(OCCCC(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-28-15-13-19-9-11-22(12-10-19)29-14-5-8-24(27)26-17-21(16-25)23(18-26)20-6-3-2-4-7-20/h2-4,6-7,9-12,21,23H,5,8,13-18,25H2,1H3/t21-,23+/m1/s1 |
| InChIKey | INUOTQMKKZPLGB-GGAORHGYSA-N |
| XLogP | 3.24 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|