C24H32N2O2 — CID 120745721
1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one (PubChem CID 120745721) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one.
| Compound Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one |
|---|---|
| PubChem CID | 120745721 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one |
| SMILES | COc1ccc(CCCCCC(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-28-22-14-12-19(13-15-22)8-4-2-7-11-24(27)26-17-21(16-25)23(18-26)20-9-5-3-6-10-20/h3,5-6,9-10,12-15,21,23H,2,4,7-8,11,16-18,25H2,1H3/t21-,23+/m1/s1 |
| InChIKey | WUNQIFMZAOFYOK-GGAORHGYSA-N |
| XLogP | 4.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|