C16H24N2OS — CID 120742447
1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 120742447) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 120742447 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCCCC(=O)N1C[C@@H](CN)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2OS/c1-20-9-5-8-16(19)18-11-14(10-17)15(12-18)13-6-3-2-4-7-13/h2-4,6-7,14-15H,5,8-12,17H2,1H3/t14-,15+/m1/s1 |
| InChIKey | VDJQDKFULLQAGZ-CABCVRRESA-N |
| XLogP | 2.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|