C22H28N2O3 — CID 120743964
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone (PubChem CID 120743964) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 120743964 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone |
| SMILES | COCCCOc1ccc(C(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-26-12-5-13-27-20-10-8-18(9-11-20)22(25)24-15-19(14-23)21(16-24)17-6-3-2-4-7-17/h2-4,6-11,19,21H,5,12-16,23H2,1H3/t19-,21+/m1/s1 |
| InChIKey | NRXRGYZSVYSROD-CTNGQTDRSA-N |
| XLogP | 2.92 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|