C21H27ClN2O3 — CID 120748899
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-[3-(3-methoxypropoxy)phenyl]methanone;hydrochloride (PubChem CID 120748899) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-[3-(3-methoxypropoxy)phenyl]methanone;hydrochloride.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-[3-(3-methoxypropoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120748899 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-[3-(3-methoxypropoxy)phenyl]methanone;hydrochloride |
| SMILES | COCCCOc1cccc(C(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)c1.Cl |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-25-11-6-12-26-18-10-5-9-17(13-18)21(24)23-14-19(20(22)15-23)16-7-3-2-4-8-16;/h2-5,7-10,13,19-20H,6,11-12,14-15,22H2,1H3;1H/t19-,20+;/m0./s1 |
| InChIKey | ZFKNETDQFOMGQI-CMXBXVFLSA-N |
| XLogP | 3.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|