C18H26ClN3O2 — CID 120746354
N-[4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride (PubChem CID 120746354) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride.
| Compound Name | N-[4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 120746354 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(C(=O)CCCNC(=O)C2CC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H25N3O2.ClH/c19-16-12-21(11-15(16)13-5-2-1-3-6-13)17(22)7-4-10-20-18(23)14-8-9-14;/h1-3,5-6,14-16H,4,7-12,19H2,(H,20,23);1H/t15-,16+;/m0./s1 |
| InChIKey | RSLPKZBYVVCDFS-IDVLALEDSA-N |
| XLogP | 1.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|